Isomaltotrionic acid

CAS No: 7632-20-4

7632-20-4
7632-57-7 Benzene, 1,1'-(cyclopropylidenemethylene)bis-
763-26-8 1,4-Butanediol, bis(dihydrogen phosphate)
7632-60-2 Benzene, 1-chloro-4-(1,2-dichloroethenyl)-, (Z)-
763-20-2 2-methylheptane-2-thiol
76326-44-8 L-Methioninamide, L-valylglycyl-L-histidyl-L-leucyl-
7632-29-3 1,2,4-Triazine-3,5(2H,4H)-dithione, 4-methyl-
7632-20-4 Isomaltotrionic acid
76315-44-1 Benzamide, N-(3-bromopropyl)-2-nitro-
76325-85-4 3,3'-(2-oxopropane-1,3-diyl)bis(1,3-dihydro-2H-indol-2-one)
76328-97-7 1-Hexen-3-one, 2-fluoro-
7632-76-0 2-Propene-1-thione, 1-(4-methoxyphenyl)-3-(1-piperidinyl)-
76313-28-5 2-Propenoic acid, 2-(acetylamino)-3-(3,4-dimethoxyphenyl)-, (Z)-
76329-55-0 1-Hexene, 3,3-diethoxy-2-fluoro-
76331-08-3 Cyclododecanone, 2-methoxy-
7631-89-2 AsNa3O4
76319-14-7 (3S)-3β-Amino-5β-methyltetrahydrofuran-2-one
76326-94-8 4-(1,2-Dimethylhydrazino)thiazol-2(5H)-one
76-31-3 Cyclopentanecarboxylic acid, 3-(((3-mercapto-2-methoxypropyl)amino)carbonyl)-2,2,3-trimethyl-, mercury complex
76325-66-1 5-bromo-3-hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one
76329-09-4 1-Octyn-4-ol, 4-(1-fluoroethenyl)-
7632-20-4 isomaltotrionic,7632-20-4
2025-10-22 Discover Isomaltotrionic acid (CAS No: 7632-20-4) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.