(22S,25S)-5,6-Didehydro-5α-spirosolane-3β-ol

CAS No: 546-40-7

546-40-7
5464-10-8 1H-inden-1-one, 2,3-dihydro-6-methoxy-2-methyl-
54646-54-7 Benzene, 1-[(3-bromo-1-butenyl)sulfonyl]-4-methyl-, (E)-
54644-49-4 Carbonic acid 3-methoxyphenyl=methyl
546-40-7 (22S,25S)-5,6-Didehydro-5α-spirosolane-3β-ol
54644-14-3 5-ETHOXY-2-PHENYLOXAZOLE-4-CARBONYL CHLORIDE
54646-67-2 2-Naphthalenol, 3-(1,1-dimethylethyl)-
54643-10-6 1-PROPANONE,1-(PYRIMIDIN-4-YL)-
5464-30-2 DL-Asparticacid, N-(2-cyanoethyl)-
5464-65-3 {[(sulfanylcarbonothioyl)imino]diethane-2,1-diyl}dicarbamodithioic acid
54644-59-6 3-[(Phenyloxycarbonyl)oxy]benzoic acid methyl ester
5464-16-4 2-aminocyclopentanone
54644-44-9 2,2-Dimethylpropanoic acid 2,6-di(isopropyl)phenyl ester
5464-15-3 1-[ethyl(methyl)amino]propan-2-ol
54644-42-7 2,2-Dimethylpropanoic acid 2-tert-butyl-4-methylphenyl ester
5464-42-6 N-(2-carboxyethyl)-N-(phenylsulfonyl)alanine
5464-05-1 benzenesulfonamide, N-(2-chlorophenyl)-3-nitro-
54642-67-0 1(3H)-Isobenzofuranone,3-[4-(diethylamino)-2-ethoxyphenyl]-3-(1-ethyl-2-methyl-1H-indol-3-yl)-7-nitro-
5464-46-0 triethyl 1-oxobutane-1,2,3-tricarboxylate
54644-43-8 2,2-Dimethylpropanoic acid 2,6-bis(1,1-dimethylethyl)-4-methylphenyl ester
54644-76-7 4,7-Methano-2,1,3-benzoxadiazole, 4,5,6,7-tetrahydro-, 1-oxide
546-40-7 didehydro,spirosolane,546-40-7
2025-10-19 Discover (22S,25S)-5,6-Didehydro-5α-spirosolane-3β-ol (CAS No: 546-40-7) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.